| Name | Dimethyl azelate |
| Synonyms | METHYL AZELATE Dimethylazelat Dimethyl azelate Dimethyl azeleate Dimethyl azelaate DIMETHYL NONANEDIOATE acelaicaciddimethylester Nonanedioic acid dimethyl AZELAIC ACID DIMETHYL ESTER NONANEDIOIC ACID DIMETHYL ESTER Dimethyl nonanedioate, Methyl azelate Dimethyl azelate,Dimethyl nonanedioate, Methyl azelate |
| CAS | 1732-10-1 |
| EINECS | 217-060-0 |
| InChI | InChI=1/C11H20O4/c1-14-10(12)8-6-4-3-5-7-9-11(13)15-2/h3-9H2,1-2H3 |
| InChIKey | DRUKNYVQGHETPO-UHFFFAOYSA-N |
| Molecular Formula | C11H20O4 |
| Molar Mass | 216.27 |
| Density | 1.007 g/mL at 25 °C (lit.) |
| Melting Point | 18 °C |
| Boling Point | 156 °C/20 mmHg (lit.) |
| Flash Point | >230°F |
| Water Solubility | 863mg/L at 25℃ |
| Solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| Vapor Presure | <1 mm Hg ( 20 °C) |
| Appearance | Liquid |
| Specific Gravity | 1.007 |
| Color | Colourless |
| Merck | 905 |
| BRN | 1710125 |
| Storage Condition | Sealed in dry,Room Temperature |
| Refractive Index | n20/D 1.435(lit.) |
| MDL | MFCD00025898 |
| Physical and Chemical Properties | Vapor pressure:<1 mm Hg ( 20 ℃) WGK Germany:1 |
| Safety Description | S23 - Do not breathe vapour. S24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 1 |
| TSCA | Yes |
| HS Code | 29171310 |
| LogP | 2.5-2.86 at 25℃ |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | dimethyl azelate is mainly used in organic synthesis or aviation fields, such as turbine engine lubricating oil, precision instrument oil, automobile engine oil, etc. |